C12H10F3N5O — CID 107377456
5-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxamide (PubChem CID 107377456) has the molecular formula C12H10F3N5O and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107377456 |
| Molecular Formula | C12H10F3N5O |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)Nc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C12H10F3N5O/c13-12(14,15)7-2-1-3-8(4-7)19-11(21)9-5-18-10(20-16)6-17-9/h1-6H,16H2,(H,18,20)(H,19,21) |
| InChIKey | NPZZWTIRXFFBGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|