C13H11F3N4O — CID 81240010
4-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 81240010) has the molecular formula C13H11F3N4O and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 4-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81240010 |
| Molecular Formula | C13H11F3N4O |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-hydrazinyl-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | NNc1ccncc1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F3N4O/c14-13(15,16)8-2-1-3-9(6-8)19-12(21)10-7-18-5-4-11(10)20-17/h1-7H,17H2,(H,18,20)(H,19,21) |
| InChIKey | JIJRWASRAVFOGS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|