C20H23N5O2 — CID 59198275
1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-[[(1R,2R)-2-hydroxycyclohexyl]methyl]urea (PubChem CID 59198275) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-[[(1R,2R)-2-hydroxycyclohexyl]methyl]urea.
| Compound Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-[[(1R,2R)-2-hydroxycyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 59198275 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[3-[2-(2-aminopyrimidin-5-yl)ethynyl]phenyl]-3-[[(1R,2R)-2-hydroxycyclohexyl]methyl]urea |
| SMILES | Nc1ncc(C#Cc2cccc(NC(=O)NC[C@H]3CCCC[C@H]3O)c2)cn1 |
| InChI | InChI=1S/C20H23N5O2/c21-19-22-11-15(12-23-19)9-8-14-4-3-6-17(10-14)25-20(27)24-13-16-5-1-2-7-18(16)26/h3-4,6,10-12,16,18,26H,1-2,5,7,13H2,(H2,21,22,23)(H2,24,25,27)/t16-,18-/m1/s1 |
| InChIKey | JDGGDTFMUOWSQX-SJLPKXTDSA-N |
| XLogP | 2.13 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|