C18H17NO2 — CID 141482066
N-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethynyl]phenyl]acetamide (PubChem CID 141482066) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethynyl]phenyl]acetamide.
| Compound Name | N-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 141482066 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C#Cc2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C18H17NO2/c1-12-9-16(10-13(2)18(12)21)8-7-15-5-4-6-17(11-15)19-14(3)20/h4-6,9-11,21H,1-3H3,(H,19,20) |
| InChIKey | XWSUVQNTTVYMAM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|