C32H32BN4NaO4 — CID 139966900
sodium tetrakis(3-acetamidophenyl)boranuide (PubChem CID 139966900) has the molecular formula C32H32BN4NaO4 and a molecular weight of 570.43 g/mol. Its IUPAC name is sodium tetrakis(3-acetamidophenyl)boranuide.
| Compound Name | sodium tetrakis(3-acetamidophenyl)boranuide |
|---|---|
| PubChem CID | 139966900 |
| Molecular Formula | C32H32BN4NaO4 |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | sodium tetrakis(3-acetamidophenyl)boranuide |
| SMILES | CC(=O)Nc1cccc([B-](c2cccc(NC(C)=O)c2)(c2cccc(NC(C)=O)c2)c2cccc(NC(C)=O)c2)c1.[Na+] |
| InChI | InChI=1S/C32H32BN4O4.Na/c1-21(38)34-29-13-5-9-25(17-29)33(26-10-6-14-30(18-26)35-22(2)39,27-11-7-15-31(19-27)36-23(3)40)28-12-8-16-32(20-28)37-24(4)41;/h5-20H,1-4H3,(H,34,38)(H,35,39)(H,36,40)(H,37,41);/q-1;+1 |
| InChIKey | RPOIRJBBSHVNCE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|