C10H9F3N2O2 — CID 895724
N-(3-acetamidophenyl)-2,2,2-trifluoroacetamide (PubChem CID 895724) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-acetamidophenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 895724 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(3-acetamidophenyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O2/c1-6(16)14-7-3-2-4-8(5-7)15-9(17)10(11,12)13/h2-5H,1H3,(H,14,16)(H,15,17) |
| InChIKey | RBVBKCBWGNLOKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |