C14H15F3N2O3 — CID 108934610
4-oxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]pentanamide (PubChem CID 108934610) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 4-oxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]pentanamide.
| Compound Name | 4-oxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 108934610 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-oxo-N-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]pentanamide |
| SMILES | CC(=O)CCC(=O)NCc1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-9(20)5-6-12(21)18-8-10-3-2-4-11(7-10)19-13(22)14(15,16)17/h2-4,7H,5-6,8H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | YBDAKOONMIVEAG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |