C13H20N2O3 — CID 174839462
acetic acid;N-[3-(propan-2-ylamino)phenyl]acetamide (PubChem CID 174839462) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is acetic acid;N-[3-(propan-2-ylamino)phenyl]acetamide.
| Compound Name | acetic acid;N-[3-(propan-2-ylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 174839462 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | acetic acid;N-[3-(propan-2-ylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(C)C)c1.CC(=O)O |
| InChI | InChI=1S/C11H16N2O.C2H4O2/c1-8(2)12-10-5-4-6-11(7-10)13-9(3)14;1-2(3)4/h4-8,12H,1-3H3,(H,13,14);1H3,(H,3,4) |
| InChIKey | KCGUOPBTZHOLAV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |