About methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide
methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide (PubChem CID 174839459) has the molecular formula C16H26N2O4
and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide.
Molecular Properties
| Compound Name | methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide |
| PubChem CID | 174839459 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(C)C)c1.CCCC(=O)OOC |
| InChI | InChI=1S/C11H16N2O.C5H10O3/c1-8(2)12-10-5-4-6-11(7-10)13-9(3)14;1-3-4-5(6)8-7-2/h4-8,12H,1-3H3,(H,13,14);3-4H2,1-2H3 |
| InChIKey | AIOMFCJZQOAGRV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide?
The IUPAC name of methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide (CID 174839459) is methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide.
What is the SMILES notation for methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide?
The canonical SMILES for methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide is CC(=O)Nc1cccc(NC(C)C)c1.CCCC(=O)OOC.
What is the InChIKey of methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide?
The InChIKey is AIOMFCJZQOAGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.C5H10O3/c1-8(2)12-10-5-4-6-11(7-10)13-9(3)14;1-3-4-5(6)8-7-2/h4-8,12H,1-3H3,(H,13,14);3-4H2,1-2H3.
What are the key properties of methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide?
methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide has a molecular weight of 310.39 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl butaneperoxoate;N-[3-(propan-2-ylamino)phenyl]acetamide is sourced from PubChem (CID 174839459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).