C18H13NOS2 — CID 30694090
3-methyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide (PubChem CID 30694090) has the molecular formula C18H13NOS2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 30694090 |
| Molecular Formula | C18H13NOS2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-methyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C18H13NOS2/c1-13-9-11-22-17(13)18(20)19-15-5-2-4-14(12-15)7-8-16-6-3-10-21-16/h2-6,9-12H,1H3,(H,19,20) |
| InChIKey | FYPLBWCTBJMCNN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|