C17H11NOS2 — CID 30395696
N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide (PubChem CID 30395696) has the molecular formula C17H11NOS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 30395696 |
| Molecular Formula | C17H11NOS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N-[3-(2-thiophen-2-ylethynyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C#Cc2cccs2)c1)c1cccs1 |
| InChI | InChI=1S/C17H11NOS2/c19-17(16-7-3-11-21-16)18-14-5-1-4-13(12-14)8-9-15-6-2-10-20-15/h1-7,10-12H,(H,18,19) |
| InChIKey | RZMJVHMRFPFGSC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|