C18H12N2OS2 — CID 46536140
2-sulfanylidene-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 46536140) has the molecular formula C18H12N2OS2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-sulfanylidene-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 2-sulfanylidene-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46536140 |
| Molecular Formula | C18H12N2OS2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-sulfanylidene-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C#Cc2cccs2)c1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C18H12N2OS2/c21-17(16-7-2-10-19-18(16)22)20-14-5-1-4-13(12-14)8-9-15-6-3-11-23-15/h1-7,10-12H,(H,19,22)(H,20,21) |
| InChIKey | PEVSWOVXAQVRHO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|