C23H16N2O4S2 — CID 71685823
2-cyclopropyl-1,1,3-trioxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1,2-benzothiazole-6-carboxamide (PubChem CID 71685823) has the molecular formula C23H16N2O4S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-cyclopropyl-1,1,3-trioxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1,2-benzothiazole-6-carboxamide.
| Compound Name | 2-cyclopropyl-1,1,3-trioxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 71685823 |
| Molecular Formula | C23H16N2O4S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-cyclopropyl-1,1,3-trioxo-N-[3-(2-thiophen-2-ylethynyl)phenyl]-1,2-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1cccc(C#Cc2cccs2)c1)c1ccc2c(c1)S(=O)(=O)N(C1CC1)C2=O |
| InChI | InChI=1S/C23H16N2O4S2/c26-22(24-17-4-1-3-15(13-17)6-10-19-5-2-12-30-19)16-7-11-20-21(14-16)31(28,29)25(23(20)27)18-8-9-18/h1-5,7,11-14,18H,8-9H2,(H,24,26) |
| InChIKey | PQTORGYBPZDIIF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|