C21H16N2O2S — CID 30594161
4-acetamido-N-[3-(2-thiophen-2-ylethynyl)phenyl]benzamide (PubChem CID 30594161) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-acetamido-N-[3-(2-thiophen-2-ylethynyl)phenyl]benzamide.
| Compound Name | 4-acetamido-N-[3-(2-thiophen-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 30594161 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-acetamido-N-[3-(2-thiophen-2-ylethynyl)phenyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2cccc(C#Cc3cccs3)c2)cc1 |
| InChI | InChI=1S/C21H16N2O2S/c1-15(24)22-18-10-8-17(9-11-18)21(25)23-19-5-2-4-16(14-19)7-12-20-6-3-13-26-20/h2-6,8-11,13-14H,1H3,(H,22,24)(H,23,25) |
| InChIKey | QRJJPDVCOWDMHP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|