C19H13NO4S2 — CID 24662927
4-[[3-(2-thiophen-2-ylethynyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 24662927) has the molecular formula C19H13NO4S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[[3-(2-thiophen-2-ylethynyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[3-(2-thiophen-2-ylethynyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 24662927 |
| Molecular Formula | C19H13NO4S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 4-[[3-(2-thiophen-2-ylethynyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cccc(C#Cc3cccs3)c2)cc1 |
| InChI | InChI=1S/C19H13NO4S2/c21-19(22)15-7-10-18(11-8-15)26(23,24)20-16-4-1-3-14(13-16)6-9-17-5-2-12-25-17/h1-5,7-8,10-13,20H,(H,21,22) |
| InChIKey | DAFQXUAFAIXYLW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|