C20H17NO5S — CID 154858217
4-[[3-(phenoxymethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 154858217) has the molecular formula C20H17NO5S and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-[[3-(phenoxymethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[3-(phenoxymethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 154858217 |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-[[3-(phenoxymethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cccc(COc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C20H17NO5S/c22-20(23)16-9-11-19(12-10-16)27(24,25)21-17-6-4-5-15(13-17)14-26-18-7-2-1-3-8-18/h1-13,21H,14H2,(H,22,23) |
| InChIKey | VXSNCHSOHWKGFK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |