C23H23F2NO3S — CID 175149395
N-[3-(3,3-difluoro-5-phenoxypentyl)phenyl]benzenesulfonamide (PubChem CID 175149395) has the molecular formula C23H23F2NO3S and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[3-(3,3-difluoro-5-phenoxypentyl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(3,3-difluoro-5-phenoxypentyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175149395 |
| Molecular Formula | C23H23F2NO3S |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[3-(3,3-difluoro-5-phenoxypentyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CCC(F)(F)CCOc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H23F2NO3S/c24-23(25,16-17-29-21-10-3-1-4-11-21)15-14-19-8-7-9-20(18-19)26-30(27,28)22-12-5-2-6-13-22/h1-13,18,26H,14-17H2 |
| InChIKey | BEUUWJMXBCZYJR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |