C24H27NO4S — CID 175149398
N-[3-[(3S)-3-hydroxy-6-phenoxyhexyl]phenyl]benzenesulfonamide (PubChem CID 175149398) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[3-[(3S)-3-hydroxy-6-phenoxyhexyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(3S)-3-hydroxy-6-phenoxyhexyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175149398 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[3-[(3S)-3-hydroxy-6-phenoxyhexyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CC[C@H](O)CCCOc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO4S/c26-22(11-8-18-29-23-12-3-1-4-13-23)17-16-20-9-7-10-21(19-20)25-30(27,28)24-14-5-2-6-15-24/h1-7,9-10,12-15,19,22,25-26H,8,11,16-18H2/t22-/m1/s1 |
| InChIKey | KXFURHRARBHDNE-JOCHJYFZSA-N |
| XLogP | 4.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|