C19H23NO5S — CID 75524807
3-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]propyl acetate (PubChem CID 75524807) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]propyl acetate.
| Compound Name | 3-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]propyl acetate |
|---|---|
| PubChem CID | 75524807 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]propyl acetate |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(CCCOC(C)=O)c2)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-3-24-18-9-11-19(12-10-18)26(22,23)20-17-8-4-6-16(14-17)7-5-13-25-15(2)21/h4,6,8-12,14,20H,3,5,7,13H2,1-2H3 |
| InChIKey | MFULABSLRDRXIH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|