C23H19NO5S — CID 25358850
3-[2-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]ethynyl]benzoic acid (PubChem CID 25358850) has the molecular formula C23H19NO5S and a molecular weight of 421.47 g/mol. Its IUPAC name is 3-[2-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]ethynyl]benzoic acid.
| Compound Name | 3-[2-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 25358850 |
| Molecular Formula | C23H19NO5S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-[2-[3-[(4-ethoxyphenyl)sulfonylamino]phenyl]ethynyl]benzoic acid |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2cccc(C#Cc3cccc(C(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C23H19NO5S/c1-2-29-21-11-13-22(14-12-21)30(27,28)24-20-8-4-6-18(16-20)10-9-17-5-3-7-19(15-17)23(25)26/h3-8,11-16,24H,2H2,1H3,(H,25,26) |
| InChIKey | PQWHHVDPBKYABE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|