C25H21NO6S — CID 31787806
3-[4-[[3-[2-(3-methoxycarbonylphenyl)ethynyl]phenyl]sulfamoyl]phenyl]propanoic acid (PubChem CID 31787806) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is 3-[4-[[3-[2-(3-methoxycarbonylphenyl)ethynyl]phenyl]sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[3-[2-(3-methoxycarbonylphenyl)ethynyl]phenyl]sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 31787806 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 3-[4-[[3-[2-(3-methoxycarbonylphenyl)ethynyl]phenyl]sulfamoyl]phenyl]propanoic acid |
| SMILES | COC(=O)c1cccc(C#Cc2cccc(NS(=O)(=O)c3ccc(CCC(=O)O)cc3)c2)c1 |
| InChI | InChI=1S/C25H21NO6S/c1-32-25(29)21-6-2-4-19(16-21)8-9-20-5-3-7-22(17-20)26-33(30,31)23-13-10-18(11-14-23)12-15-24(27)28/h2-7,10-11,13-14,16-17,26H,12,15H2,1H3,(H,27,28) |
| InChIKey | LYRBIMVNWQLRSE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|