C22H21NO4S — CID 175145699
N-[3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]phenyl]benzenesulfonamide (PubChem CID 175145699) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]phenyl]benzenesulfonamide.
| Compound Name | N-[3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175145699 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[3-[(E)-3-hydroxy-4-phenoxybut-1-enyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(/C=C/C(O)COc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO4S/c24-20(17-27-21-10-3-1-4-11-21)15-14-18-8-7-9-19(16-18)23-28(25,26)22-12-5-2-6-13-22/h1-16,20,23-24H,17H2/b15-14+ |
| InChIKey | QGRQKRRGSQPSEB-CCEZHUSRSA-N |
| XLogP | 3.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |