About N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide
N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide (PubChem CID 175359261) has the molecular formula C22H27NO4S
and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide |
| PubChem CID | 175359261 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(/C=C/[C@H](O)CCOc2ccccc2)c1)C1CCCC1 |
| InChI | InChI=1S/C22H27NO4S/c24-20(15-16-27-21-9-2-1-3-10-21)14-13-18-7-6-8-19(17-18)23-28(25,26)22-11-4-5-12-22/h1-3,6-10,13-14,17,20,22-24H,4-5,11-12,15-16H2/b14-13+/t20-/m0/s1 |
| InChIKey | WPYSCFBNOLDUTA-AIGDTVQASA-N |
| XLogP | 4.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide?
The IUPAC name of N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide (CID 175359261) is N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide.
What is the SMILES notation for N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide?
The canonical SMILES for N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide is O=S(=O)(Nc1cccc(/C=C/[C@H](O)CCOc2ccccc2)c1)C1CCCC1.
What is the InChIKey of N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide?
The InChIKey is WPYSCFBNOLDUTA-AIGDTVQASA-N. The full InChI is InChI=1S/C22H27NO4S/c24-20(15-16-27-21-9-2-1-3-10-21)14-13-18-7-6-8-19(17-18)23-28(25,26)22-11-4-5-12-22/h1-3,6-10,13-14,17,20,22-24H,4-5,11-12,15-16H2/b14-13+/t20-/m0/s1.
What are the key properties of N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide?
N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide has a molecular weight of 401.53 g/mol, XLogP of 4.21, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(E,3R)-3-hydroxy-5-phenoxypent-1-enyl]phenyl]cyclopentanesulfonamide is sourced from PubChem (CID 175359261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).