C25H33NO6S — CID 146319060
3-[2-[(3S)-5-[3-(cyclopentylsulfonylamino)phenyl]-3-hydroxypentoxy]phenyl]propanoic acid (PubChem CID 146319060) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-[2-[(3S)-5-[3-(cyclopentylsulfonylamino)phenyl]-3-hydroxypentoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-[(3S)-5-[3-(cyclopentylsulfonylamino)phenyl]-3-hydroxypentoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 146319060 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[2-[(3S)-5-[3-(cyclopentylsulfonylamino)phenyl]-3-hydroxypentoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1OCC[C@@H](O)CCc1cccc(NS(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C25H33NO6S/c27-22(16-17-32-24-11-4-1-7-20(24)13-15-25(28)29)14-12-19-6-5-8-21(18-19)26-33(30,31)23-9-2-3-10-23/h1,4-8,11,18,22-23,26-27H,2-3,9-10,12-17H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | IVRBFGWMSGWWAL-QFIPXVFZSA-N |
| XLogP | 4.15 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |