C13H14N2O4S2 — CID 51097761
N-[3-(sulfamoylmethyl)phenyl]benzenesulfonamide (PubChem CID 51097761) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[3-(sulfamoylmethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(sulfamoylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51097761 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-[3-(sulfamoylmethyl)phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)Cc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C13H14N2O4S2/c14-20(16,17)10-11-5-4-6-12(9-11)15-21(18,19)13-7-2-1-3-8-13/h1-9,15H,10H2,(H2,14,16,17) |
| InChIKey | SAPOLNKQPSIUDL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |