C56H50N4O12S6 — CID 162165374
N-[2-(benzenesulfonamido)phenyl]benzenesulfonamide;N-[4-(benzenesulfonamido)phenyl]benzenesulfonamide;1,3-bis(benzenesulfonylmethyl)benzene (PubChem CID 162165374) has the molecular formula C56H50N4O12S6 and a molecular weight of 1163.43 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)phenyl]benzenesulfonamide;N-[4-(benzenesulfonamido)phenyl]benzenesulfonamide;1,3-bis(benzenesulfonylmethyl)benzene.
| Compound Name | N-[2-(benzenesulfonamido)phenyl]benzenesulfonamide;N-[4-(benzenesulfonamido)phenyl]benzenesulfonamide;1,3-bis(benzenesulfonylmethyl)benzene |
|---|---|
| PubChem CID | 162165374 |
| Molecular Formula | C56H50N4O12S6 |
| Molecular Weight | 1163.43 g/mol |
| Exact Mass | 1162.17 |
| IUPAC Name | N-[2-(benzenesulfonamido)phenyl]benzenesulfonamide;N-[4-(benzenesulfonamido)phenyl]benzenesulfonamide;1,3-bis(benzenesulfonylmethyl)benzene |
| SMILES | O=S(=O)(Cc1cccc(CS(=O)(=O)c2ccccc2)c1)c1ccccc1.O=S(=O)(Nc1ccc(NS(=O)(=O)c2ccccc2)cc1)c1ccccc1.O=S(=O)(Nc1ccccc1NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18O4S2.2C18H16N2O4S2/c21-25(22,19-10-3-1-4-11-19)15-17-8-7-9-18(14-17)16-26(23,24)20-12-5-2-6-13-20;21-25(22,15-9-3-1-4-10-15)19-17-13-7-8-14-18(17)20-26(23,24)16-11-5-2-6-12-16;21-25(22,17-7-3-1-4-8-17)19-15-11-13-16(14-12-15)20-26(23,24)18-9-5-2-6-10-18/h1-14H,15-16H2;2*1-14,19-20H |
| InChIKey | ZNAZMTHXYACPBZ-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 252.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.43 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|