About 2-fluoroethanamine;N-phenylbenzenesulfonamide
2-fluoroethanamine;N-phenylbenzenesulfonamide (PubChem CID 175323476) has the molecular formula C14H17FN2O2S
and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-fluoroethanamine;N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoroethanamine;N-phenylbenzenesulfonamide |
| PubChem CID | 175323476 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-fluoroethanamine;N-phenylbenzenesulfonamide |
| SMILES | NCCF.O=S(=O)(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2S.C2H6FN/c14-16(15,12-9-5-2-6-10-12)13-11-7-3-1-4-8-11;3-1-2-4/h1-10,13H;1-2,4H2 |
| InChIKey | GHADLHOKUWRLGC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoroethanamine;N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethanamine;N-phenylbenzenesulfonamide?
The IUPAC name of 2-fluoroethanamine;N-phenylbenzenesulfonamide (CID 175323476) is 2-fluoroethanamine;N-phenylbenzenesulfonamide.
What is the SMILES notation for 2-fluoroethanamine;N-phenylbenzenesulfonamide?
The canonical SMILES for 2-fluoroethanamine;N-phenylbenzenesulfonamide is NCCF.O=S(=O)(Nc1ccccc1)c1ccccc1.
What is the InChIKey of 2-fluoroethanamine;N-phenylbenzenesulfonamide?
The InChIKey is GHADLHOKUWRLGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S.C2H6FN/c14-16(15,12-9-5-2-6-10-12)13-11-7-3-1-4-8-11;3-1-2-4/h1-10,13H;1-2,4H2.
What are the key properties of 2-fluoroethanamine;N-phenylbenzenesulfonamide?
2-fluoroethanamine;N-phenylbenzenesulfonamide has a molecular weight of 296.37 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethanamine;N-phenylbenzenesulfonamide is sourced from PubChem (CID 175323476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).