C28H24N2O6S — CID 142866107
5-methyl-2-[[4-[(3-phenylmethoxyphenyl)sulfamoyl]benzoyl]amino]benzoic acid (PubChem CID 142866107) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is 5-methyl-2-[[4-[(3-phenylmethoxyphenyl)sulfamoyl]benzoyl]amino]benzoic acid.
| Compound Name | 5-methyl-2-[[4-[(3-phenylmethoxyphenyl)sulfamoyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142866107 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 5-methyl-2-[[4-[(3-phenylmethoxyphenyl)sulfamoyl]benzoyl]amino]benzoic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(S(=O)(=O)Nc3cccc(OCc4ccccc4)c3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C28H24N2O6S/c1-19-10-15-26(25(16-19)28(32)33)29-27(31)21-11-13-24(14-12-21)37(34,35)30-22-8-5-9-23(17-22)36-18-20-6-3-2-4-7-20/h2-17,30H,18H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | MFSSIXQOJMPFGR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |