C32H33N3O5S — CID 18174478
2-[(4-tert-butylbenzoyl)amino]-4-(methanesulfonamido)-N-(3-phenylmethoxyphenyl)benzamide (PubChem CID 18174478) has the molecular formula C32H33N3O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-4-(methanesulfonamido)-N-(3-phenylmethoxyphenyl)benzamide.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-4-(methanesulfonamido)-N-(3-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 18174478 |
| Molecular Formula | C32H33N3O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-4-(methanesulfonamido)-N-(3-phenylmethoxyphenyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc(NS(C)(=O)=O)ccc2C(=O)Nc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H33N3O5S/c1-32(2,3)24-15-13-23(14-16-24)30(36)34-29-20-26(35-41(4,38)39)17-18-28(29)31(37)33-25-11-8-12-27(19-25)40-21-22-9-6-5-7-10-22/h5-20,35H,21H2,1-4H3,(H,33,37)(H,34,36) |
| InChIKey | IGSONJDKNMQPFT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |