C26H22NO5PS — CID 2041723
4-[[3-(diphenylphosphorylmethyl)phenyl]sulfamoyl]benzoic acid (PubChem CID 2041723) has the molecular formula C26H22NO5PS and a molecular weight of 491.51 g/mol. Its IUPAC name is 4-[[3-(diphenylphosphorylmethyl)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[3-(diphenylphosphorylmethyl)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 2041723 |
| Molecular Formula | C26H22NO5PS |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 4-[[3-(diphenylphosphorylmethyl)phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cccc(CP(=O)(c3ccccc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H22NO5PS/c28-26(29)21-14-16-25(17-15-21)34(31,32)27-22-9-7-8-20(18-22)19-33(30,23-10-3-1-4-11-23)24-12-5-2-6-13-24/h1-18,27H,19H2,(H,28,29) |
| InChIKey | HXCKCSQLJNWAIG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|