C22H18N2O4S — CID 67094243
1-[[3-(benzenesulfonamido)phenyl]methyl]indole-6-carboxylic acid (PubChem CID 67094243) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[[3-(benzenesulfonamido)phenyl]methyl]indole-6-carboxylic acid.
| Compound Name | 1-[[3-(benzenesulfonamido)phenyl]methyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 67094243 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[[3-(benzenesulfonamido)phenyl]methyl]indole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccn(Cc3cccc(NS(=O)(=O)c4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C22H18N2O4S/c25-22(26)18-10-9-17-11-12-24(21(17)14-18)15-16-5-4-6-19(13-16)23-29(27,28)20-7-2-1-3-8-20/h1-14,23H,15H2,(H,25,26) |
| InChIKey | SNEHTFOKQZESTG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |