C37H28N2O2 — CID 90682150
3-[[6-[1-[(4-phenylphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 90682150) has the molecular formula C37H28N2O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-[[6-[1-[(4-phenylphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[1-[(4-phenylphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90682150 |
| Molecular Formula | C37H28N2O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 3-[[6-[1-[(4-phenylphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2ccc3ccc(-c4ccc5ccn(Cc6ccc(-c7ccccc7)cc6)c5c4)cc32)c1 |
| InChI | InChI=1S/C37H28N2O2/c40-37(41)34-8-4-5-27(21-34)25-39-20-18-31-14-16-33(23-36(31)39)32-15-13-30-17-19-38(35(30)22-32)24-26-9-11-29(12-10-26)28-6-2-1-3-7-28/h1-23H,24-25H2,(H,40,41) |
| InChIKey | VWTYGELZJXJVFQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |