C24H22N2O5S2 — CID 42939238
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide (PubChem CID 42939238) has the molecular formula C24H22N2O5S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 42939238 |
| Molecular Formula | C24H22N2O5S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
| SMILES | CC(NS(=O)(=O)c1ccc2c(c1)OCCCO2)C(=O)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C24H22N2O5S2/c1-17(26-33(28,29)21-10-11-22-23(16-21)31-13-4-12-30-22)24(27)25-19-6-2-5-18(15-19)8-9-20-7-3-14-32-20/h2-3,5-7,10-11,14-17,26H,4,12-13H2,1H3,(H,25,27) |
| InChIKey | CVSVUBMKKLJWJG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|