C22H18N2O2S — CID 35230081
N-[2-oxo-2-[3-(2-thiophen-2-ylethynyl)anilino]ethyl]-2-phenylacetamide (PubChem CID 35230081) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[2-oxo-2-[3-(2-thiophen-2-ylethynyl)anilino]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-oxo-2-[3-(2-thiophen-2-ylethynyl)anilino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 35230081 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[2-oxo-2-[3-(2-thiophen-2-ylethynyl)anilino]ethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C22H18N2O2S/c25-21(15-17-6-2-1-3-7-17)23-16-22(26)24-19-9-4-8-18(14-19)11-12-20-10-5-13-27-20/h1-10,13-14H,15-16H2,(H,23,25)(H,24,26) |
| InChIKey | RLTKDCCKDWGDOM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|