C21H14N2OS3 — CID 18208686
N-[3-(2-thiophen-2-ylethynyl)phenyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 18208686) has the molecular formula C21H14N2OS3 and a molecular weight of 406.56 g/mol. Its IUPAC name is N-[3-(2-thiophen-2-ylethynyl)phenyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-(2-thiophen-2-ylethynyl)phenyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18208686 |
| Molecular Formula | C21H14N2OS3 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-[3-(2-thiophen-2-ylethynyl)phenyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C21H14N2OS3/c24-20(13-17-14-27-21(23-17)19-7-3-11-26-19)22-16-5-1-4-15(12-16)8-9-18-6-2-10-25-18/h1-7,10-12,14H,13H2,(H,22,24) |
| InChIKey | CVRIKVSEANENHV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|