C21H14N2O2S2 — CID 18226286
N-dibenzofuran-2-yl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 18226286) has the molecular formula C21H14N2O2S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-dibenzofuran-2-yl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-dibenzofuran-2-yl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18226286 |
| Molecular Formula | C21H14N2O2S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-dibenzofuran-2-yl-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)Nc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C21H14N2O2S2/c24-20(11-14-12-27-21(23-14)19-6-3-9-26-19)22-13-7-8-18-16(10-13)15-4-1-2-5-17(15)25-18/h1-10,12H,11H2,(H,22,24) |
| InChIKey | UUDYNGVQAZUMIO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |