C15H13N3O3S3 — CID 34751638
N-(3-sulfamoylphenyl)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 34751638) has the molecular formula C15H13N3O3S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is N-(3-sulfamoylphenyl)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(3-sulfamoylphenyl)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 34751638 |
| Molecular Formula | C15H13N3O3S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-(3-sulfamoylphenyl)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)Cc2csc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C15H13N3O3S3/c16-24(20,21)12-4-1-3-10(7-12)17-14(19)8-11-9-23-15(18-11)13-5-2-6-22-13/h1-7,9H,8H2,(H,17,19)(H2,16,20,21) |
| InChIKey | YORZHPQTBPKRSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |