C20H14FNOS2 — CID 30769927
2-(2-fluorophenyl)sulfanyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide (PubChem CID 30769927) has the molecular formula C20H14FNOS2 and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30769927 |
| Molecular Formula | C20H14FNOS2 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(2-thiophen-2-ylethynyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C20H14FNOS2/c21-18-8-1-2-9-19(18)25-14-20(23)22-16-6-3-5-15(13-16)10-11-17-7-4-12-24-17/h1-9,12-13H,14H2,(H,22,23) |
| InChIKey | VJKYEXSOLOQXBR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|