C21H15N3O2S2 — CID 46419795
3-(4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide (PubChem CID 46419795) has the molecular formula C21H15N3O2S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide.
| Compound Name | 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46419795 |
| Molecular Formula | C21H15N3O2S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 3-(4-oxothieno[2,3-d]pyrimidin-3-yl)-N-[3-(2-thiophen-2-ylethynyl)phenyl]propanamide |
| SMILES | O=C(CCn1cnc2sccc2c1=O)Nc1cccc(C#Cc2cccs2)c1 |
| InChI | InChI=1S/C21H15N3O2S2/c25-19(8-10-24-14-22-20-18(21(24)26)9-12-28-20)23-16-4-1-3-15(13-16)6-7-17-5-2-11-27-17/h1-5,9,11-14H,8,10H2,(H,23,25) |
| InChIKey | YCOKTUBSNVBGAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|