C25H19N3O2 — CID 112838330
N-(3-ethynylphenyl)-2-[[3-(2-phenylethynyl)phenyl]carbamoylamino]acetamide (PubChem CID 112838330) has the molecular formula C25H19N3O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[3-(2-phenylethynyl)phenyl]carbamoylamino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[3-(2-phenylethynyl)phenyl]carbamoylamino]acetamide |
|---|---|
| PubChem CID | 112838330 |
| Molecular Formula | C25H19N3O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[3-(2-phenylethynyl)phenyl]carbamoylamino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)Nc2cccc(C#Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H19N3O2/c1-2-19-10-6-12-22(16-19)27-24(29)18-26-25(30)28-23-13-7-11-21(17-23)15-14-20-8-4-3-5-9-20/h1,3-13,16-17H,18H2,(H,27,29)(H2,26,28,30) |
| InChIKey | ASMFHQSIOVDVLW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|