C16H15NO — CID 141482059
4-[2-(3-aminophenyl)ethynyl]-2,6-dimethylphenol (PubChem CID 141482059) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[2-(3-aminophenyl)ethynyl]-2,6-dimethylphenol.
| Compound Name | 4-[2-(3-aminophenyl)ethynyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 141482059 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-[2-(3-aminophenyl)ethynyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C#Cc2cccc(N)c2)cc(C)c1O |
| InChI | InChI=1S/C16H15NO/c1-11-8-14(9-12(2)16(11)18)7-6-13-4-3-5-15(17)10-13/h3-5,8-10,18H,17H2,1-2H3 |
| InChIKey | PBOYEFWUDKCVCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|