C14H8F3N — CID 60800655
3-[2-(2,4,6-trifluorophenyl)ethynyl]aniline (PubChem CID 60800655) has the molecular formula C14H8F3N and a molecular weight of 247.22 g/mol. Its IUPAC name is 3-[2-(2,4,6-trifluorophenyl)ethynyl]aniline.
| Compound Name | 3-[2-(2,4,6-trifluorophenyl)ethynyl]aniline |
|---|---|
| PubChem CID | 60800655 |
| Molecular Formula | C14H8F3N |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-[2-(2,4,6-trifluorophenyl)ethynyl]aniline |
| SMILES | Nc1cccc(C#Cc2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C14H8F3N/c15-10-7-13(16)12(14(17)8-10)5-4-9-2-1-3-11(18)6-9/h1-3,6-8H,18H2 |
| InChIKey | GASWYFKWJHGCNS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|