C20H11F3 — CID 126725710
1,3,5-trifluoro-2-[2-(4-phenylphenyl)ethynyl]benzene (PubChem CID 126725710) has the molecular formula C20H11F3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-[2-(4-phenylphenyl)ethynyl]benzene.
| Compound Name | 1,3,5-trifluoro-2-[2-(4-phenylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 126725710 |
| Molecular Formula | C20H11F3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1,3,5-trifluoro-2-[2-(4-phenylphenyl)ethynyl]benzene |
| SMILES | Fc1cc(F)c(C#Cc2ccc(-c3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C20H11F3/c21-17-12-19(22)18(20(23)13-17)11-8-14-6-9-16(10-7-14)15-4-2-1-3-5-15/h1-7,9-10,12-13H |
| InChIKey | RRJHQJFACJPDTH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|