C21H16F2 — CID 164526566
1,3-difluoro-2-[2-(4-phenylphenyl)ethynyl]benzene;methane (PubChem CID 164526566) has the molecular formula C21H16F2 and a molecular weight of 306.35 g/mol. Its IUPAC name is 1,3-difluoro-2-[2-(4-phenylphenyl)ethynyl]benzene;methane.
| Compound Name | 1,3-difluoro-2-[2-(4-phenylphenyl)ethynyl]benzene;methane |
|---|---|
| PubChem CID | 164526566 |
| Molecular Formula | C21H16F2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1,3-difluoro-2-[2-(4-phenylphenyl)ethynyl]benzene;methane |
| SMILES | C.Fc1cccc(F)c1C#Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H12F2.CH4/c21-19-7-4-8-20(22)18(19)14-11-15-9-12-17(13-10-15)16-5-2-1-3-6-16;/h1-10,12-13H;1H4 |
| InChIKey | ZGBJWHBASPCDOE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|