C16H13F2N — CID 118387940
4-[2-(2,6-difluorophenyl)ethynyl]-N,N-dimethylaniline (PubChem CID 118387940) has the molecular formula C16H13F2N and a molecular weight of 257.28 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenyl)ethynyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(2,6-difluorophenyl)ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 118387940 |
| Molecular Formula | C16H13F2N |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-[2-(2,6-difluorophenyl)ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H13F2N/c1-19(2)13-9-6-12(7-10-13)8-11-14-15(17)4-3-5-16(14)18/h3-7,9-10H,1-2H3 |
| InChIKey | QZZYWTILFJLXLF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|