C21H10F3NS — CID 163272892
[3,5-difluoro-4-[2-(2-fluoro-4-phenylphenyl)ethynyl]phenyl] thiocyanate (PubChem CID 163272892) has the molecular formula C21H10F3NS and a molecular weight of 365.38 g/mol. Its IUPAC name is [3,5-difluoro-4-[2-(2-fluoro-4-phenylphenyl)ethynyl]phenyl] thiocyanate.
| Compound Name | [3,5-difluoro-4-[2-(2-fluoro-4-phenylphenyl)ethynyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 163272892 |
| Molecular Formula | C21H10F3NS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [3,5-difluoro-4-[2-(2-fluoro-4-phenylphenyl)ethynyl]phenyl] thiocyanate |
| SMILES | N#CSc1cc(F)c(C#Cc2ccc(-c3ccccc3)cc2F)c(F)c1 |
| InChI | InChI=1S/C21H10F3NS/c22-19-10-16(14-4-2-1-3-5-14)7-6-15(19)8-9-18-20(23)11-17(26-13-25)12-21(18)24/h1-7,10-12H |
| InChIKey | PAVRRLVWLXSMDW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|