C22H12F2NRuS — CID 165392422
[3,5-difluoro-4-[2-(2-methyl-4-phenylphenyl)ethynyl]phenyl] thiocyanate;ruthenium(1+) (PubChem CID 165392422) has the molecular formula C22H12F2NRuS and a molecular weight of 461.48 g/mol. Its IUPAC name is [3,5-difluoro-4-[2-(2-methyl-4-phenylphenyl)ethynyl]phenyl] thiocyanate;ruthenium(1+).
| Compound Name | [3,5-difluoro-4-[2-(2-methyl-4-phenylphenyl)ethynyl]phenyl] thiocyanate;ruthenium(1+) |
|---|---|
| PubChem CID | 165392422 |
| Molecular Formula | C22H12F2NRuS |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | [3,5-difluoro-4-[2-(2-methyl-4-phenylphenyl)ethynyl]phenyl] thiocyanate;ruthenium(1+) |
| SMILES | Cc1cc(-c2cc[c-]cc2)ccc1C#Cc1c(F)cc(SC#N)cc1F.[Ru+] |
| InChI | InChI=1S/C22H12F2NS.Ru/c1-15-11-18(17-5-3-2-4-6-17)8-7-16(15)9-10-20-21(23)12-19(26-14-25)13-22(20)24;/h3-8,11-13H,1H3;/q-1;+1 |
| InChIKey | CUMMBVILHGLJOQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|