C24H16F3NOS — CID 155260675
[2-methyl-4-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]phenyl] thiocyanate (PubChem CID 155260675) has the molecular formula C24H16F3NOS and a molecular weight of 423.46 g/mol. Its IUPAC name is [2-methyl-4-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]phenyl] thiocyanate.
| Compound Name | [2-methyl-4-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]phenyl] thiocyanate |
|---|---|
| PubChem CID | 155260675 |
| Molecular Formula | C24H16F3NOS |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [2-methyl-4-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]phenyl] thiocyanate |
| SMILES | Cc1cc(-c2ccc(SC#N)c(C)c2)ccc1C#Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16F3NOS/c1-16-13-20(21-9-12-23(30-15-28)17(2)14-21)8-7-19(16)6-3-18-4-10-22(11-5-18)29-24(25,26)27/h4-5,7-14H,1-2H3 |
| InChIKey | IJVORKQMKOEUIQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|