C23H14F3NOS — CID 155260774
1-isothiocyanato-2-methyl-4-[4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]benzene (PubChem CID 155260774) has the molecular formula C23H14F3NOS and a molecular weight of 409.43 g/mol. Its IUPAC name is 1-isothiocyanato-2-methyl-4-[4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]benzene.
| Compound Name | 1-isothiocyanato-2-methyl-4-[4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]benzene |
|---|---|
| PubChem CID | 155260774 |
| Molecular Formula | C23H14F3NOS |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1-isothiocyanato-2-methyl-4-[4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]benzene |
| SMILES | Cc1cc(-c2ccc(C#Cc3ccc(OC(F)(F)F)cc3)cc2)ccc1N=C=S |
| InChI | InChI=1S/C23H14F3NOS/c1-16-14-20(10-13-22(16)27-15-29)19-8-4-17(5-9-19)2-3-18-6-11-21(12-7-18)28-23(24,25)26/h4-14H,1H3 |
| InChIKey | VKBQBVWNIIAZBJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|