C22H12ClF3N2OS — CID 164525952
[5-chloro-6-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-3-pyridinyl] thiocyanate (PubChem CID 164525952) has the molecular formula C22H12ClF3N2OS and a molecular weight of 444.87 g/mol. Its IUPAC name is [5-chloro-6-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-3-pyridinyl] thiocyanate.
| Compound Name | [5-chloro-6-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-3-pyridinyl] thiocyanate |
|---|---|
| PubChem CID | 164525952 |
| Molecular Formula | C22H12ClF3N2OS |
| Molecular Weight | 444.87 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | [5-chloro-6-[3-methyl-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-3-pyridinyl] thiocyanate |
| SMILES | Cc1cc(-c2ncc(SC#N)cc2Cl)ccc1C#Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H12ClF3N2OS/c1-14-10-17(21-20(23)11-19(12-28-21)30-13-27)7-6-16(14)5-2-15-3-8-18(9-4-15)29-22(24,25)26/h3-4,6-12H,1H3 |
| InChIKey | XXISPVQFTKIBMV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.87 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|